C26H32F3N3O3 — CID 166460826
(3Z,5E)-5-[1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-4-(3,3,3-trifluoropropyl)piperazin-2-yl]-2-methylidenehepta-3,5-dienoic acid (PubChem CID 166460826) has the molecular formula C26H32F3N3O3 and a molecular weight of 491.55 g/mol. Its IUPAC name is (3Z,5E)-5-[1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-4-(3,3,3-trifluoropropyl)piperazin-2-yl]-2-methylidenehepta-3,5-dienoic acid.
| Compound Name | (3Z,5E)-5-[1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-4-(3,3,3-trifluoropropyl)piperazin-2-yl]-2-methylidenehepta-3,5-dienoic acid |
|---|---|
| PubChem CID | 166460826 |
| Molecular Formula | C26H32F3N3O3 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | (3Z,5E)-5-[1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-4-(3,3,3-trifluoropropyl)piperazin-2-yl]-2-methylidenehepta-3,5-dienoic acid |
| SMILES | C=C(/C=C\C(=C/C)C1CN(CCC(F)(F)F)CCN1Cc1c(OC)cc(C)c2[nH]ccc12)C(=O)O |
| InChI | InChI=1S/C26H32F3N3O3/c1-5-19(7-6-17(2)25(33)34)22-16-31(11-9-26(27,28)29)12-13-32(22)15-21-20-8-10-30-24(20)18(3)14-23(21)35-4/h5-8,10,14,22,30H,2,9,11-13,15-16H2,1,3-4H3,(H,33,34)/b7-6-,19-5+ |
| InChIKey | AXYKDMSQCKMMBW-QAMTYVMHSA-N |
| XLogP | 5.07 |
| TPSA | 68.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|