C21H29F3N2O3 — CID 166475646
ethyl 2-[4-[(4aS,8aR)-3,3-dimethyl-2,4,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-3-fluoro-2-methylphenoxy]-2,2-difluoroacetate (PubChem CID 166475646) has the molecular formula C21H29F3N2O3 and a molecular weight of 414.47 g/mol. Its IUPAC name is ethyl 2-[4-[(4aS,8aR)-3,3-dimethyl-2,4,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-3-fluoro-2-methylphenoxy]-2,2-difluoroacetate.
| Compound Name | ethyl 2-[4-[(4aS,8aR)-3,3-dimethyl-2,4,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-3-fluoro-2-methylphenoxy]-2,2-difluoroacetate |
|---|---|
| PubChem CID | 166475646 |
| Molecular Formula | C21H29F3N2O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | ethyl 2-[4-[(4aS,8aR)-3,3-dimethyl-2,4,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-3-fluoro-2-methylphenoxy]-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)Oc1ccc(N2CC(C)(C)N[C@H]3CCCC[C@H]32)c(F)c1C |
| InChI | InChI=1S/C21H29F3N2O3/c1-5-28-19(27)21(23,24)29-17-11-10-16(18(22)13(17)2)26-12-20(3,4)25-14-8-6-7-9-15(14)26/h10-11,14-15,25H,5-9,12H2,1-4H3/t14-,15+/m0/s1 |
| InChIKey | NHDSPWWFRYIEFT-LSDHHAIUSA-N |
| XLogP | 4.17 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|