C34H40N2O3Si — CID 166524907
tert-butyl 3-[(E)-5-[tert-butyl(diphenyl)silyl]oxypent-1-enyl]quinoxaline-2-carboxylate (PubChem CID 166524907) has the molecular formula C34H40N2O3Si and a molecular weight of 552.79 g/mol. Its IUPAC name is tert-butyl 3-[(E)-5-[tert-butyl(diphenyl)silyl]oxypent-1-enyl]quinoxaline-2-carboxylate.
| Compound Name | tert-butyl 3-[(E)-5-[tert-butyl(diphenyl)silyl]oxypent-1-enyl]quinoxaline-2-carboxylate |
|---|---|
| PubChem CID | 166524907 |
| Molecular Formula | C34H40N2O3Si |
| Molecular Weight | 552.79 g/mol |
| Exact Mass | 552.28 |
| IUPAC Name | tert-butyl 3-[(E)-5-[tert-butyl(diphenyl)silyl]oxypent-1-enyl]quinoxaline-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1nc2ccccc2nc1/C=C/CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H40N2O3Si/c1-33(2,3)39-32(37)31-30(35-28-22-15-16-23-29(28)36-31)24-14-9-17-25-38-40(34(4,5)6,26-18-10-7-11-19-26)27-20-12-8-13-21-27/h7-8,10-16,18-24H,9,17,25H2,1-6H3/b24-14+ |
| InChIKey | VFMPYFCUBMETFR-ZVHZXABRSA-N |
| XLogP | 6.96 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.79 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|