C10H15N3O3 — CID 166528322
N-[3-(2-hydroxy-2-methylcyclobutyl)oxy-1-(trideuteriomethyl)pyrazol-4-yl]formamide (PubChem CID 166528322) has the molecular formula C10H15N3O3 and a molecular weight of 228.27 g/mol. Its IUPAC name is N-[3-(2-hydroxy-2-methylcyclobutyl)oxy-1-(trideuteriomethyl)pyrazol-4-yl]formamide.
| Compound Name | N-[3-(2-hydroxy-2-methylcyclobutyl)oxy-1-(trideuteriomethyl)pyrazol-4-yl]formamide |
|---|---|
| PubChem CID | 166528322 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | N-[3-(2-hydroxy-2-methylcyclobutyl)oxy-1-(trideuteriomethyl)pyrazol-4-yl]formamide |
| SMILES | [2H]C([2H])([2H])n1cc(NC=O)c(OC2CCC2(C)O)n1 |
| InChI | InChI=1S/C10H15N3O3/c1-10(15)4-3-8(10)16-9-7(11-6-14)5-13(2)12-9/h5-6,8,15H,3-4H2,1-2H3,(H,11,14)/i2D3 |
| InChIKey | SGTBLIDOKCCUEG-BMSJAHLVSA-N |
| XLogP | 0.28 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|