C21H17FN4O2 — CID 166539433
[4-(5-ethynyl-2-fluoroanilino)quinazolin-6-yl] pyrrolidine-1-carboxylate (PubChem CID 166539433) has the molecular formula C21H17FN4O2 and a molecular weight of 376.39 g/mol. Its IUPAC name is [4-(5-ethynyl-2-fluoroanilino)quinazolin-6-yl] pyrrolidine-1-carboxylate.
| Compound Name | [4-(5-ethynyl-2-fluoroanilino)quinazolin-6-yl] pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 166539433 |
| Molecular Formula | C21H17FN4O2 |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | [4-(5-ethynyl-2-fluoroanilino)quinazolin-6-yl] pyrrolidine-1-carboxylate |
| SMILES | C#Cc1ccc(F)c(Nc2ncnc3ccc(OC(=O)N4CCCC4)cc23)c1 |
| InChI | InChI=1S/C21H17FN4O2/c1-2-14-5-7-17(22)19(11-14)25-20-16-12-15(6-8-18(16)23-13-24-20)28-21(27)26-9-3-4-10-26/h1,5-8,11-13H,3-4,9-10H2,(H,23,24,25) |
| InChIKey | JKOFVKBIIIEBMP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|