C22H37FN2O2 — CID 166619335
N-[[(1S,5S,6R,7R)-3-(5-fluoropentyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]cycloheptanecarboxamide (PubChem CID 166619335) has the molecular formula C22H37FN2O2 and a molecular weight of 380.55 g/mol. Its IUPAC name is N-[[(1S,5S,6R,7R)-3-(5-fluoropentyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]cycloheptanecarboxamide.
| Compound Name | N-[[(1S,5S,6R,7R)-3-(5-fluoropentyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]cycloheptanecarboxamide |
|---|---|
| PubChem CID | 166619335 |
| Molecular Formula | C22H37FN2O2 |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 380.28 |
| IUPAC Name | N-[[(1S,5S,6R,7R)-3-(5-fluoropentyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]cycloheptanecarboxamide |
| SMILES | O=C(NC[C@H]1[C@H]2CN(CCCCCF)C[C@]23CC[C@H]1O3)C1CCCCCC1 |
| InChI | InChI=1S/C22H37FN2O2/c23-12-6-3-7-13-25-15-19-18(20-10-11-22(19,16-25)27-20)14-24-21(26)17-8-4-1-2-5-9-17/h17-20H,1-16H2,(H,24,26)/t18-,19+,20+,22+/m0/s1 |
| InChIKey | DCFBIRJNTWUVJV-GPQLQYNLSA-N |
| XLogP | 3.69 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|