2-[(1Z,3E)-hepta-1,3-dienyl]-4,6-dihydroxybenzoic acid

C14H16O4 — CID 166624714

IUPAC2-[(1Z,3E)-hepta-1,3-dienyl]-4,6-dihydroxybenzoic acid
SMILESCCC/C=C/C=C\c1cc(O)cc(O)c1C(=O)O
InChIInChI=1S/C14H16O4/c1-2-3-4-5-6-7-10-8-11(15)9-12(16)13(10)14(17)18/h4-9,15-16H,2-3H2,1H3,(H,17,18)/b5-4+,7-6-
InChIKeyDKWXMRWVMLGZCC-DEQVHDEQSA-N
MW248.28 g/mol
LogP3.17
Rot. Bonds5

About 2-[(1Z,3E)-hepta-1,3-dienyl]-4,6-dihydroxybenzoic acid

2-[(1Z,3E)-hepta-1,3-dienyl]-4,6-dihydroxybenzoic acid (PubChem CID 166624714) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is 2-[(1Z,3E)-hepta-1,3-dienyl]-4,6-dihydroxybenzoic acid.

Molecular Properties

Compound Name2-[(1Z,3E)-hepta-1,3-dienyl]-4,6-dihydroxybenzoic acid
PubChem CID166624714
Molecular FormulaC14H16O4
Molecular Weight248.28 g/mol
Exact Mass248.10
IUPAC Name2-[(1Z,3E)-hepta-1,3-dienyl]-4,6-dihydroxybenzoic acid
SMILESCCC/C=C/C=C\c1cc(O)cc(O)c1C(=O)O
InChIInChI=1S/C14H16O4/c1-2-3-4-5-6-7-10-8-11(15)9-12(16)13(10)14(17)18/h4-9,15-16H,2-3H2,1H3,(H,17,18)/b5-4+,7-6-
InChIKeyDKWXMRWVMLGZCC-DEQVHDEQSA-N
XLogP3.17
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.28
LogP ≤ 53.17
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 2-[(1Z,3E)-hepta-1,3-dienyl]-4,6-dihydroxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(1Z,3E)-hepta-1,3-dienyl]-4,6-dihydroxybenzoic acid?
The IUPAC name of 2-[(1Z,3E)-hepta-1,3-dienyl]-4,6-dihydroxybenzoic acid (CID 166624714) is 2-[(1Z,3E)-hepta-1,3-dienyl]-4,6-dihydroxybenzoic acid.
What is the SMILES notation for 2-[(1Z,3E)-hepta-1,3-dienyl]-4,6-dihydroxybenzoic acid?
The canonical SMILES for 2-[(1Z,3E)-hepta-1,3-dienyl]-4,6-dihydroxybenzoic acid is CCC/C=C/C=C\c1cc(O)cc(O)c1C(=O)O.
What is the InChIKey of 2-[(1Z,3E)-hepta-1,3-dienyl]-4,6-dihydroxybenzoic acid?
The InChIKey is DKWXMRWVMLGZCC-DEQVHDEQSA-N. The full InChI is InChI=1S/C14H16O4/c1-2-3-4-5-6-7-10-8-11(15)9-12(16)13(10)14(17)18/h4-9,15-16H,2-3H2,1H3,(H,17,18)/b5-4+,7-6-.
What are the key properties of 2-[(1Z,3E)-hepta-1,3-dienyl]-4,6-dihydroxybenzoic acid?
2-[(1Z,3E)-hepta-1,3-dienyl]-4,6-dihydroxybenzoic acid has a molecular weight of 248.28 g/mol, XLogP of 3.17, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1Z,3E)-hepta-1,3-dienyl]-4,6-dihydroxybenzoic acid is sourced from PubChem (CID 166624714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).