C14H16O4 — CID 166624714
2-[(1Z,3E)-hepta-1,3-dienyl]-4,6-dihydroxybenzoic acid (PubChem CID 166624714) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is 2-[(1Z,3E)-hepta-1,3-dienyl]-4,6-dihydroxybenzoic acid.
| Compound Name | 2-[(1Z,3E)-hepta-1,3-dienyl]-4,6-dihydroxybenzoic acid |
|---|---|
| PubChem CID | 166624714 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 2-[(1Z,3E)-hepta-1,3-dienyl]-4,6-dihydroxybenzoic acid |
| SMILES | CCC/C=C/C=C\c1cc(O)cc(O)c1C(=O)O |
| InChI | InChI=1S/C14H16O4/c1-2-3-4-5-6-7-10-8-11(15)9-12(16)13(10)14(17)18/h4-9,15-16H,2-3H2,1H3,(H,17,18)/b5-4+,7-6- |
| InChIKey | DKWXMRWVMLGZCC-DEQVHDEQSA-N |
| XLogP | 3.17 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|