C12H19NO4 — CID 166639016
3-(cyclopropanecarbonyl)-3-hydroxy-4-(trimethylazaniumyl)pent-4-enoate (PubChem CID 166639016) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is 3-(cyclopropanecarbonyl)-3-hydroxy-4-(trimethylazaniumyl)pent-4-enoate.
| Compound Name | 3-(cyclopropanecarbonyl)-3-hydroxy-4-(trimethylazaniumyl)pent-4-enoate |
|---|---|
| PubChem CID | 166639016 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 3-(cyclopropanecarbonyl)-3-hydroxy-4-(trimethylazaniumyl)pent-4-enoate |
| SMILES | C=C(C(O)(CC(=O)[O-])C(=O)C1CC1)[N+](C)(C)C |
| InChI | InChI=1S/C12H19NO4/c1-8(13(2,3)4)12(17,7-10(14)15)11(16)9-5-6-9/h9,17H,1,5-7H2,2-4H3 |
| InChIKey | SHGRVZURPSRPDE-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|