C26H40FN3O6 — CID 166688078
[[(5R)-3-[3-fluoro-4-(2-hydroxyethylamino)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl-heptanoylamino] heptanoate (PubChem CID 166688078) has the molecular formula C26H40FN3O6 and a molecular weight of 509.62 g/mol. Its IUPAC name is [[(5R)-3-[3-fluoro-4-(2-hydroxyethylamino)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl-heptanoylamino] heptanoate.
| Compound Name | [[(5R)-3-[3-fluoro-4-(2-hydroxyethylamino)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl-heptanoylamino] heptanoate |
|---|---|
| PubChem CID | 166688078 |
| Molecular Formula | C26H40FN3O6 |
| Molecular Weight | 509.62 g/mol |
| Exact Mass | 509.29 |
| IUPAC Name | [[(5R)-3-[3-fluoro-4-(2-hydroxyethylamino)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl-heptanoylamino] heptanoate |
| SMILES | CCCCCCC(=O)ON(C[C@H]1CN(c2ccc(NCCO)c(F)c2)C(=O)O1)C(=O)CCCCCC |
| InChI | InChI=1S/C26H40FN3O6/c1-3-5-7-9-11-24(32)30(36-25(33)12-10-8-6-4-2)19-21-18-29(26(34)35-21)20-13-14-23(22(27)17-20)28-15-16-31/h13-14,17,21,28,31H,3-12,15-16,18-19H2,1-2H3/t21-/m1/s1 |
| InChIKey | CRPITAVPLBYUSH-OAQYLSRUSA-N |
| XLogP | 4.78 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.62 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|