C24H24O4P+ — CID 166723640
(3-benzoyl-2,4,6-trimethylbenzoyl)-hydroxy-methoxy-phenylphosphanium (PubChem CID 166723640) has the molecular formula C24H24O4P+ and a molecular weight of 407.43 g/mol. Its IUPAC name is (3-benzoyl-2,4,6-trimethylbenzoyl)-hydroxy-methoxy-phenylphosphanium.
| Compound Name | (3-benzoyl-2,4,6-trimethylbenzoyl)-hydroxy-methoxy-phenylphosphanium |
|---|---|
| PubChem CID | 166723640 |
| Molecular Formula | C24H24O4P+ |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | (3-benzoyl-2,4,6-trimethylbenzoyl)-hydroxy-methoxy-phenylphosphanium |
| SMILES | CO[P+](O)(C(=O)c1c(C)cc(C)c(C(=O)c2ccccc2)c1C)c1ccccc1 |
| InChI | InChI=1S/C24H24O4P/c1-16-15-17(2)22(18(3)21(16)23(25)19-11-7-5-8-12-19)24(26)29(27,28-4)20-13-9-6-10-14-20/h5-15,27H,1-4H3/q+1 |
| InChIKey | WMSUZDHMBWHIFU-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|