C23H26FN5O — CID 166755543
2-cyclohexyl-5-(2-fluoro-4-phenoxyphenyl)-3-(methylamino)imidazole-4-carboximidamide (PubChem CID 166755543) has the molecular formula C23H26FN5O and a molecular weight of 407.49 g/mol. Its IUPAC name is 2-cyclohexyl-5-(2-fluoro-4-phenoxyphenyl)-3-(methylamino)imidazole-4-carboximidamide.
| Compound Name | 2-cyclohexyl-5-(2-fluoro-4-phenoxyphenyl)-3-(methylamino)imidazole-4-carboximidamide |
|---|---|
| PubChem CID | 166755543 |
| Molecular Formula | C23H26FN5O |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 2-cyclohexyl-5-(2-fluoro-4-phenoxyphenyl)-3-(methylamino)imidazole-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(-c2ccc(Oc3ccccc3)cc2F)nc(C2CCCCC2)n1NC |
| InChI | InChI=1S/C23H26FN5O/c1-27-29-21(22(25)26)20(28-23(29)15-8-4-2-5-9-15)18-13-12-17(14-19(18)24)30-16-10-6-3-7-11-16/h3,6-7,10-15,27H,2,4-5,8-9H2,1H3,(H3,25,26) |
| InChIKey | MNFOCEUMRVLOAJ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 88.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|