C15H16N2O2 — CID 166780458
9-methyl-2-[2-(oxetan-3-yl)ethynyl]-6,7-dihydro-5H-pyrido[2,3-b]azepin-8-one (PubChem CID 166780458) has the molecular formula C15H16N2O2 and a molecular weight of 256.30 g/mol. Its IUPAC name is 9-methyl-2-[2-(oxetan-3-yl)ethynyl]-6,7-dihydro-5H-pyrido[2,3-b]azepin-8-one.
| Compound Name | 9-methyl-2-[2-(oxetan-3-yl)ethynyl]-6,7-dihydro-5H-pyrido[2,3-b]azepin-8-one |
|---|---|
| PubChem CID | 166780458 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 9-methyl-2-[2-(oxetan-3-yl)ethynyl]-6,7-dihydro-5H-pyrido[2,3-b]azepin-8-one |
| SMILES | CN1C(=O)CCCc2ccc(C#CC3COC3)nc21 |
| InChI | InChI=1S/C15H16N2O2/c1-17-14(18)4-2-3-12-6-8-13(16-15(12)17)7-5-11-9-19-10-11/h6,8,11H,2-4,9-10H2,1H3 |
| InChIKey | ZTNJNCDNILXMAF-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|