C12H16N2 — CID 166830045
N-[(E)-(2,4,5-trimethylphenyl)methylideneamino]ethenamine (PubChem CID 166830045) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is N-[(E)-(2,4,5-trimethylphenyl)methylideneamino]ethenamine.
| Compound Name | N-[(E)-(2,4,5-trimethylphenyl)methylideneamino]ethenamine |
|---|---|
| PubChem CID | 166830045 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | N-[(E)-(2,4,5-trimethylphenyl)methylideneamino]ethenamine |
| SMILES | C=CN/N=C/c1cc(C)c(C)cc1C |
| InChI | InChI=1S/C12H16N2/c1-5-13-14-8-12-7-10(3)9(2)6-11(12)4/h5-8,13H,1H2,2-4H3/b14-8+ |
| InChIKey | PEGNUVCXJLFUKU-RIYZIHGNSA-N |
| XLogP | 2.68 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|