C21H20N2O3 — CID 166963826
2-methoxy-6-[(Z)-2-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)ethenyl]phenol (PubChem CID 166963826) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is 2-methoxy-6-[(Z)-2-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)ethenyl]phenol.
| Compound Name | 2-methoxy-6-[(Z)-2-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)ethenyl]phenol |
|---|---|
| PubChem CID | 166963826 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 2-methoxy-6-[(Z)-2-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)ethenyl]phenol |
| SMILES | COc1ccc2c3c([nH]c2c1)C(/C=C\c1cccc(OC)c1O)=NCC3 |
| InChI | InChI=1S/C21H20N2O3/c1-25-14-7-8-15-16-10-11-22-17(20(16)23-18(15)12-14)9-6-13-4-3-5-19(26-2)21(13)24/h3-9,12,23-24H,10-11H2,1-2H3/b9-6- |
| InChIKey | UYRLWDVOUYWGRB-TWGQIWQCSA-N |
| XLogP | 3.95 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|