C20H18IN3O — CID 170657113
4-iodo-2-[(E)-2-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)ethenyl]aniline (PubChem CID 170657113) has the molecular formula C20H18IN3O and a molecular weight of 443.29 g/mol. Its IUPAC name is 4-iodo-2-[(E)-2-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)ethenyl]aniline.
| Compound Name | 4-iodo-2-[(E)-2-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 170657113 |
| Molecular Formula | C20H18IN3O |
| Molecular Weight | 443.29 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | 4-iodo-2-[(E)-2-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)ethenyl]aniline |
| SMILES | COc1ccc2c3c([nH]c2c1)C(/C=C/c1cc(I)ccc1N)=NCC3 |
| InChI | InChI=1S/C20H18IN3O/c1-25-14-4-5-15-16-8-9-23-18(20(16)24-19(15)11-14)7-2-12-10-13(21)3-6-17(12)22/h2-7,10-11,24H,8-9,22H2,1H3/b7-2+ |
| InChIKey | YGRXLDKNESPZSK-FARCUNLSSA-N |
| XLogP | 4.42 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.29 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|