C16H23N3O3 — CID 166981356
(3Z,5E)-3-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-2-methyliminoocta-3,5-dienal (PubChem CID 166981356) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is (3Z,5E)-3-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-2-methyliminoocta-3,5-dienal.
| Compound Name | (3Z,5E)-3-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-2-methyliminoocta-3,5-dienal |
|---|---|
| PubChem CID | 166981356 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | (3Z,5E)-3-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-2-methyliminoocta-3,5-dienal |
| SMILES | CC/C=C/C=C(CN(C)C1CCC(=O)NC1=O)\C(C=O)=N\C |
| InChI | InChI=1S/C16H23N3O3/c1-4-5-6-7-12(13(11-20)17-2)10-19(3)14-8-9-15(21)18-16(14)22/h5-7,11,14H,4,8-10H2,1-3H3,(H,18,21,22)/b6-5+,12-7-,17-13+ |
| InChIKey | XCSXKKYYCRPJMC-WLGRHWGWSA-N |
| XLogP | 0.89 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|