C10H22N2O3 — CID 167121741
2-hydroperoxypropan-2-yl N,N'-di(propan-2-yl)carbamimidate (PubChem CID 167121741) has the molecular formula C10H22N2O3 and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-hydroperoxypropan-2-yl N,N'-di(propan-2-yl)carbamimidate.
| Compound Name | 2-hydroperoxypropan-2-yl N,N'-di(propan-2-yl)carbamimidate |
|---|---|
| PubChem CID | 167121741 |
| Molecular Formula | C10H22N2O3 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | 2-hydroperoxypropan-2-yl N,N'-di(propan-2-yl)carbamimidate |
| SMILES | CC(C)/N=C(\NC(C)C)OC(C)(C)OO |
| InChI | InChI=1S/C10H22N2O3/c1-7(2)11-9(12-8(3)4)14-10(5,6)15-13/h7-8,13H,1-6H3,(H,11,12) |
| InChIKey | YNETYXSVJONANR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|