C23H37N7O2 — CID 167298630
(Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-3-[[5-(2,2-dimethylcyclopropyl)-1,2,4-oxadiazolidin-3-ylidene]amino]prop-1-en-1-amine (PubChem CID 167298630) has the molecular formula C23H37N7O2 and a molecular weight of 443.60 g/mol. Its IUPAC name is (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-3-[[5-(2,2-dimethylcyclopropyl)-1,2,4-oxadiazolidin-3-ylidene]amino]prop-1-en-1-amine.
| Compound Name | (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-3-[[5-(2,2-dimethylcyclopropyl)-1,2,4-oxadiazolidin-3-ylidene]amino]prop-1-en-1-amine |
|---|---|
| PubChem CID | 167298630 |
| Molecular Formula | C23H37N7O2 |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.30 |
| IUPAC Name | (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-3-[[5-(2,2-dimethylcyclopropyl)-1,2,4-oxadiazolidin-3-ylidene]amino]prop-1-en-1-amine |
| SMILES | Cc1nc(/C(N)=C(\C/N=C2\NOC(C3CC3(C)C)N2)N(C)N)ccc1OC1CCCCC1 |
| InChI | InChI=1S/C23H37N7O2/c1-14-19(31-15-8-6-5-7-9-15)11-10-17(27-14)20(24)18(30(4)25)13-26-22-28-21(32-29-22)16-12-23(16,2)3/h10-11,15-16,21H,5-9,12-13,24-25H2,1-4H3,(H2,26,28,29)/b20-18- |
| InChIKey | XUBQLWAVKGPSJO-ZZEZOPTASA-N |
| XLogP | 2.39 |
| TPSA | 123.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|