C20H36N4O2 — CID 167380527
N-[4-(3-aminopropanoylamino)cyclohexyl]-4,7-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 167380527) has the molecular formula C20H36N4O2 and a molecular weight of 364.53 g/mol. Its IUPAC name is N-[4-(3-aminopropanoylamino)cyclohexyl]-4,7-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | N-[4-(3-aminopropanoylamino)cyclohexyl]-4,7-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 167380527 |
| Molecular Formula | C20H36N4O2 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.28 |
| IUPAC Name | N-[4-(3-aminopropanoylamino)cyclohexyl]-4,7-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CC1CCC(C)C2NC(C(=O)NC3CCC(NC(=O)CCN)CC3)CC12 |
| InChI | InChI=1S/C20H36N4O2/c1-12-3-4-13(2)19-16(12)11-17(24-19)20(26)23-15-7-5-14(6-8-15)22-18(25)9-10-21/h12-17,19,24H,3-11,21H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | CKTNFUFIIQJEIZ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |