C29H34N5O5S- — CID 167469943
[3-[2-[1-[1-(2,6-dioxopiperidin-3-yl)-3-methylindol-5-yl]piperidin-4-yl]ethylcarbamoylamino]phenyl]methanesulfinate (PubChem CID 167469943) has the molecular formula C29H34N5O5S- and a molecular weight of 564.69 g/mol. Its IUPAC name is [3-[2-[1-[1-(2,6-dioxopiperidin-3-yl)-3-methylindol-5-yl]piperidin-4-yl]ethylcarbamoylamino]phenyl]methanesulfinate.
| Compound Name | [3-[2-[1-[1-(2,6-dioxopiperidin-3-yl)-3-methylindol-5-yl]piperidin-4-yl]ethylcarbamoylamino]phenyl]methanesulfinate |
|---|---|
| PubChem CID | 167469943 |
| Molecular Formula | C29H34N5O5S- |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | [3-[2-[1-[1-(2,6-dioxopiperidin-3-yl)-3-methylindol-5-yl]piperidin-4-yl]ethylcarbamoylamino]phenyl]methanesulfinate |
| SMILES | Cc1cn(C2CCC(=O)NC2=O)c2ccc(N3CCC(CCNC(=O)Nc4cccc(CS(=O)[O-])c4)CC3)cc12 |
| InChI | InChI=1S/C29H35N5O5S/c1-19-17-34(26-7-8-27(35)32-28(26)36)25-6-5-23(16-24(19)25)33-13-10-20(11-14-33)9-12-30-29(37)31-22-4-2-3-21(15-22)18-40(38)39/h2-6,15-17,20,26H,7-14,18H2,1H3,(H,38,39)(H2,30,31,37)(H,32,35,36)/p-1 |
| InChIKey | GCPDXZRKQICNQP-UHFFFAOYSA-M |
| XLogP | 3.73 |
| TPSA | 135.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|