About 1H-indole;3-methylsulfonyl-1H-indole
1H-indole;3-methylsulfonyl-1H-indole (PubChem CID 167634446) has the molecular formula C17H16N2O2S
and a molecular weight of 312.39 g/mol. Its IUPAC name is 1H-indole;3-methylsulfonyl-1H-indole.
Molecular Properties
| Compound Name | 1H-indole;3-methylsulfonyl-1H-indole |
| PubChem CID | 167634446 |
| Molecular Formula | C17H16N2O2S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 1H-indole;3-methylsulfonyl-1H-indole |
| SMILES | CS(=O)(=O)c1c[nH]c2ccccc12.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C9H9NO2S.C8H7N/c1-13(11,12)9-6-10-8-5-3-2-4-7(8)9;1-2-4-8-7(3-1)5-6-9-8/h2-6,10H,1H3;1-6,9H |
| InChIKey | OGRDVGYPMAJTAA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-indole;3-methylsulfonyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indole;3-methylsulfonyl-1H-indole?
The IUPAC name of 1H-indole;3-methylsulfonyl-1H-indole (CID 167634446) is 1H-indole;3-methylsulfonyl-1H-indole.
What is the SMILES notation for 1H-indole;3-methylsulfonyl-1H-indole?
The canonical SMILES for 1H-indole;3-methylsulfonyl-1H-indole is CS(=O)(=O)c1c[nH]c2ccccc12.c1ccc2[nH]ccc2c1.
What is the InChIKey of 1H-indole;3-methylsulfonyl-1H-indole?
The InChIKey is OGRDVGYPMAJTAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2S.C8H7N/c1-13(11,12)9-6-10-8-5-3-2-4-7(8)9;1-2-4-8-7(3-1)5-6-9-8/h2-6,10H,1H3;1-6,9H.
What are the key properties of 1H-indole;3-methylsulfonyl-1H-indole?
1H-indole;3-methylsulfonyl-1H-indole has a molecular weight of 312.39 g/mol, XLogP of 3.74, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indole;3-methylsulfonyl-1H-indole is sourced from PubChem (CID 167634446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).