About CID 167709256
CID 167709256 (PubChem CID 167709256) has the molecular formula C30H29B3BrN10O6
and a molecular weight of 737.97 g/mol.
Molecular Properties
| Compound Name | CID 167709256 |
| PubChem CID | 167709256 |
| Molecular Formula | C30H29B3BrN10O6 |
| Molecular Weight | 737.97 g/mol |
| Exact Mass | 737.17 |
| IUPAC Name | — |
| SMILES | Nc1ccc(-c2nc(-c3ccc(N)cc3)nc(-c3ccc(N)cc3)n2)cc1.Nc1ccc(Br)cc1.O[B]Oc1nc(B(O)O)nc(B(O)O)n1 |
| InChI | InChI=1S/C21H18N6.C6H6BrN.C3H5B3N3O6/c22-16-7-1-13(2-8-16)19-25-20(14-3-9-17(23)10-4-14)27-21(26-19)15-5-11-18(24)12-6-15;7-5-1-3-6(8)4-2-5;10-4-15-3-8-1(5(11)12)7-2(9-3)6(13)14/h1-12H,22-24H2;1-4H,8H2;10-14H |
| InChIKey | PUPJEWDMUZAXDC-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 291.80 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 737.97 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 16 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 167709256 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167709256?
The IUPAC name of CID 167709256 (CID 167709256) is not available.
What is the SMILES notation for CID 167709256?
The canonical SMILES for CID 167709256 is Nc1ccc(-c2nc(-c3ccc(N)cc3)nc(-c3ccc(N)cc3)n2)cc1.Nc1ccc(Br)cc1.O[B]Oc1nc(B(O)O)nc(B(O)O)n1.
What is the InChIKey of CID 167709256?
The InChIKey is PUPJEWDMUZAXDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N6.C6H6BrN.C3H5B3N3O6/c22-16-7-1-13(2-8-16)19-25-20(14-3-9-17(23)10-4-14)27-21(26-19)15-5-11-18(24)12-6-15;7-5-1-3-6(8)4-2-5;10-4-15-3-8-1(5(11)12)7-2(9-3)6(13)14/h1-12H,22-24H2;1-4H,8H2;10-14H.
What are the key properties of CID 167709256?
CID 167709256 has a molecular weight of 737.97 g/mol, XLogP of -0.21, 7 rotatable bonds, 9 hydrogen bond donors, and 16 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167709256 is sourced from PubChem (CID 167709256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).