C18H19NO6S — CID 167776993
3-[(3-hydroxy-4-phenylbutanoyl)amino]-5-methylsulfonylbenzoic acid (PubChem CID 167776993) has the molecular formula C18H19NO6S and a molecular weight of 377.42 g/mol. Its IUPAC name is 3-[(3-hydroxy-4-phenylbutanoyl)amino]-5-methylsulfonylbenzoic acid.
| Compound Name | 3-[(3-hydroxy-4-phenylbutanoyl)amino]-5-methylsulfonylbenzoic acid |
|---|---|
| PubChem CID | 167776993 |
| Molecular Formula | C18H19NO6S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 3-[(3-hydroxy-4-phenylbutanoyl)amino]-5-methylsulfonylbenzoic acid |
| SMILES | CS(=O)(=O)c1cc(NC(=O)CC(O)Cc2ccccc2)cc(C(=O)O)c1 |
| InChI | InChI=1S/C18H19NO6S/c1-26(24,25)16-9-13(18(22)23)8-14(10-16)19-17(21)11-15(20)7-12-5-3-2-4-6-12/h2-6,8-10,15,20H,7,11H2,1H3,(H,19,21)(H,22,23) |
| InChIKey | KGHSNHRKKMGCBE-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |