C18H25N5O3 — CID 167944450
N-[4-(dimethylamino)-6-methoxypyrimidin-5-yl]-2-(furan-2-yl)azepane-1-carboxamide (PubChem CID 167944450) has the molecular formula C18H25N5O3 and a molecular weight of 359.43 g/mol. Its IUPAC name is N-[4-(dimethylamino)-6-methoxypyrimidin-5-yl]-2-(furan-2-yl)azepane-1-carboxamide.
| Compound Name | N-[4-(dimethylamino)-6-methoxypyrimidin-5-yl]-2-(furan-2-yl)azepane-1-carboxamide |
|---|---|
| PubChem CID | 167944450 |
| Molecular Formula | C18H25N5O3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | N-[4-(dimethylamino)-6-methoxypyrimidin-5-yl]-2-(furan-2-yl)azepane-1-carboxamide |
| SMILES | COc1ncnc(N(C)C)c1NC(=O)N1CCCCCC1c1ccco1 |
| InChI | InChI=1S/C18H25N5O3/c1-22(2)16-15(17(25-3)20-12-19-16)21-18(24)23-10-6-4-5-8-13(23)14-9-7-11-26-14/h7,9,11-13H,4-6,8,10H2,1-3H3,(H,21,24) |
| InChIKey | NEIWNMUKFGFQRU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 83.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |