C18H20N2O7 — CID 168570020
dimethyl (E)-2-[[6-(2-oxopiperidin-1-yl)-1,3-benzodioxol-5-yl]amino]but-2-enedioate (PubChem CID 168570020) has the molecular formula C18H20N2O7 and a molecular weight of 376.37 g/mol. Its IUPAC name is dimethyl (E)-2-[[6-(2-oxopiperidin-1-yl)-1,3-benzodioxol-5-yl]amino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[[6-(2-oxopiperidin-1-yl)-1,3-benzodioxol-5-yl]amino]but-2-enedioate |
|---|---|
| PubChem CID | 168570020 |
| Molecular Formula | C18H20N2O7 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | dimethyl (E)-2-[[6-(2-oxopiperidin-1-yl)-1,3-benzodioxol-5-yl]amino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1cc2c(cc1N1CCCCC1=O)OCO2)C(=O)OC |
| InChI | InChI=1S/C18H20N2O7/c1-24-17(22)8-12(18(23)25-2)19-11-7-14-15(27-10-26-14)9-13(11)20-6-4-3-5-16(20)21/h7-9,19H,3-6,10H2,1-2H3/b12-8+ |
| InChIKey | GACMIWAEMWQVJY-XYOKQWHBSA-N |
| XLogP | 1.57 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|