C21H24FN3O2S — CID 168611676
benzyl N'-[[4-fluoro-2-(oxolan-2-ylmethoxymethyl)phenyl]methylideneamino]carbamimidothioate (PubChem CID 168611676) has the molecular formula C21H24FN3O2S and a molecular weight of 401.51 g/mol. Its IUPAC name is benzyl N'-[[4-fluoro-2-(oxolan-2-ylmethoxymethyl)phenyl]methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[[4-fluoro-2-(oxolan-2-ylmethoxymethyl)phenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168611676 |
| Molecular Formula | C21H24FN3O2S |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | benzyl N'-[[4-fluoro-2-(oxolan-2-ylmethoxymethyl)phenyl]methylideneamino]carbamimidothioate |
| SMILES | NC(=NN=Cc1ccc(F)cc1COCC1CCCO1)SCc1ccccc1 |
| InChI | InChI=1S/C21H24FN3O2S/c22-19-9-8-17(18(11-19)13-26-14-20-7-4-10-27-20)12-24-25-21(23)28-15-16-5-2-1-3-6-16/h1-3,5-6,8-9,11-12,20H,4,7,10,13-15H2,(H2,23,25) |
| InChIKey | OFCZQRKZWGDPIZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|