C24H28N3O2S+ — CID 168728577
1-(3-methylimidazol-3-ium-1-yl)sulfonyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)piperidine (PubChem CID 168728577) has the molecular formula C24H28N3O2S+ and a molecular weight of 422.57 g/mol. Its IUPAC name is 1-(3-methylimidazol-3-ium-1-yl)sulfonyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)piperidine.
| Compound Name | 1-(3-methylimidazol-3-ium-1-yl)sulfonyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)piperidine |
|---|---|
| PubChem CID | 168728577 |
| Molecular Formula | C24H28N3O2S+ |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 1-(3-methylimidazol-3-ium-1-yl)sulfonyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)piperidine |
| SMILES | C[n+]1ccn(S(=O)(=O)N2CCCC(C3c4ccccc4CCc4ccccc43)C2)c1 |
| InChI | InChI=1S/C24H28N3O2S/c1-25-15-16-27(18-25)30(28,29)26-14-6-9-21(17-26)24-22-10-4-2-7-19(22)12-13-20-8-3-5-11-23(20)24/h2-5,7-8,10-11,15-16,18,21,24H,6,9,12-14,17H2,1H3/q+1 |
| InChIKey | KHKDQJLLWAGBLD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 46.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|