C21H40N4O2 — CID 168747568
1-[6-[2-(tert-butylamino)ethyl-[2-(propan-2-ylamino)ethyl]amino]hexyl]pyrrole-2,5-dione (PubChem CID 168747568) has the molecular formula C21H40N4O2 and a molecular weight of 380.58 g/mol. Its IUPAC name is 1-[6-[2-(tert-butylamino)ethyl-[2-(propan-2-ylamino)ethyl]amino]hexyl]pyrrole-2,5-dione.
| Compound Name | 1-[6-[2-(tert-butylamino)ethyl-[2-(propan-2-ylamino)ethyl]amino]hexyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168747568 |
| Molecular Formula | C21H40N4O2 |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.32 |
| IUPAC Name | 1-[6-[2-(tert-butylamino)ethyl-[2-(propan-2-ylamino)ethyl]amino]hexyl]pyrrole-2,5-dione |
| SMILES | CC(C)NCCN(CCCCCCN1C(=O)C=CC1=O)CCNC(C)(C)C |
| InChI | InChI=1S/C21H40N4O2/c1-18(2)22-12-16-24(17-13-23-21(3,4)5)14-8-6-7-9-15-25-19(26)10-11-20(25)27/h10-11,18,22-23H,6-9,12-17H2,1-5H3 |
| InChIKey | NGXATHNSYUAEHW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|