C22H31N3O5 — CID 168757473
5-[(2Z)-2-[3a-(3,4-dimethoxyphenyl)-1-methyl-2,3,4,5,7,7a-hexahydroindol-6-ylidene]hydrazinyl]-5-oxopentanoic acid (PubChem CID 168757473) has the molecular formula C22H31N3O5 and a molecular weight of 417.51 g/mol. Its IUPAC name is 5-[(2Z)-2-[3a-(3,4-dimethoxyphenyl)-1-methyl-2,3,4,5,7,7a-hexahydroindol-6-ylidene]hydrazinyl]-5-oxopentanoic acid.
| Compound Name | 5-[(2Z)-2-[3a-(3,4-dimethoxyphenyl)-1-methyl-2,3,4,5,7,7a-hexahydroindol-6-ylidene]hydrazinyl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 168757473 |
| Molecular Formula | C22H31N3O5 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 5-[(2Z)-2-[3a-(3,4-dimethoxyphenyl)-1-methyl-2,3,4,5,7,7a-hexahydroindol-6-ylidene]hydrazinyl]-5-oxopentanoic acid |
| SMILES | COc1ccc(C23CC/C(=N/NC(=O)CCCC(=O)O)CC2N(C)CC3)cc1OC |
| InChI | InChI=1S/C22H31N3O5/c1-25-12-11-22(15-7-8-17(29-2)18(13-15)30-3)10-9-16(14-19(22)25)23-24-20(26)5-4-6-21(27)28/h7-8,13,19H,4-6,9-12,14H2,1-3H3,(H,24,26)(H,27,28)/b23-16- |
| InChIKey | PZNQRXIWJHGDKG-KQWNVCNZSA-N |
| XLogP | 2.56 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|