C24H30N4O4 — CID 174066648
1-[[3a-(3,4-dimethoxyphenyl)-1-methyl-2,3,4,5,7,7a-hexahydroindol-6-ylidene]amino]-3-(3-hydroxyphenyl)urea (PubChem CID 174066648) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is 1-[[3a-(3,4-dimethoxyphenyl)-1-methyl-2,3,4,5,7,7a-hexahydroindol-6-ylidene]amino]-3-(3-hydroxyphenyl)urea.
| Compound Name | 1-[[3a-(3,4-dimethoxyphenyl)-1-methyl-2,3,4,5,7,7a-hexahydroindol-6-ylidene]amino]-3-(3-hydroxyphenyl)urea |
|---|---|
| PubChem CID | 174066648 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 1-[[3a-(3,4-dimethoxyphenyl)-1-methyl-2,3,4,5,7,7a-hexahydroindol-6-ylidene]amino]-3-(3-hydroxyphenyl)urea |
| SMILES | COc1ccc(C23CCC(=NNC(=O)Nc4cccc(O)c4)CC2N(C)CC3)cc1OC |
| InChI | InChI=1S/C24H30N4O4/c1-28-12-11-24(16-7-8-20(31-2)21(13-16)32-3)10-9-18(15-22(24)28)26-27-23(30)25-17-5-4-6-19(29)14-17/h4-8,13-14,22,29H,9-12,15H2,1-3H3,(H2,25,27,30) |
| InChIKey | VQUVNJPCIKSFQQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|