C21H30ClN6O12P — CID 168863843
[[2-[[(2R,3S,4R,5R)-5-[2-chloro-6-[[(3S)-oxolan-3-yl]amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]-2-oxoethoxy]-hydroxyphosphoryl]oxymethyl ethyl carbonate (PubChem CID 168863843) has the molecular formula C21H30ClN6O12P and a molecular weight of 624.93 g/mol. Its IUPAC name is [[2-[[(2R,3S,4R,5R)-5-[2-chloro-6-[[(3S)-oxolan-3-yl]amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]-2-oxoethoxy]-hydroxyphosphoryl]oxymethyl ethyl carbonate.
| Compound Name | [[2-[[(2R,3S,4R,5R)-5-[2-chloro-6-[[(3S)-oxolan-3-yl]amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]-2-oxoethoxy]-hydroxyphosphoryl]oxymethyl ethyl carbonate |
|---|---|
| PubChem CID | 168863843 |
| Molecular Formula | C21H30ClN6O12P |
| Molecular Weight | 624.93 g/mol |
| Exact Mass | 624.13 |
| IUPAC Name | [[2-[[(2R,3S,4R,5R)-5-[2-chloro-6-[[(3S)-oxolan-3-yl]amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]-2-oxoethoxy]-hydroxyphosphoryl]oxymethyl ethyl carbonate |
| SMILES | CCOC(=O)OCOP(=O)(O)OCC(=O)N(C)C[C@H]1O[C@@H](n2cnc3c(N[C@H]4CCOC4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H30ClN6O12P/c1-3-36-21(32)37-10-39-41(33,34)38-8-13(29)27(2)6-12-15(30)16(31)19(40-12)28-9-23-14-17(24-11-4-5-35-7-11)25-20(22)26-18(14)28/h9,11-12,15-16,19,30-31H,3-8,10H2,1-2H3,(H,33,34)(H,24,25,26)/t11-,12+,15+,16+,19+/m0/s1 |
| InChIKey | TUSRJBSKXDRFBA-NSDPQSHHSA-N |
| XLogP | 0.02 |
| TPSA | 226.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.93 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|