C12H22N2OS — CID 168901457
3,5-dimethyl-1,2-thiazole;ethane;1-methylpyrrolidin-2-one (PubChem CID 168901457) has the molecular formula C12H22N2OS and a molecular weight of 242.39 g/mol. Its IUPAC name is 3,5-dimethyl-1,2-thiazole;ethane;1-methylpyrrolidin-2-one.
| Compound Name | 3,5-dimethyl-1,2-thiazole;ethane;1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168901457 |
| Molecular Formula | C12H22N2OS |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 3,5-dimethyl-1,2-thiazole;ethane;1-methylpyrrolidin-2-one |
| SMILES | CC.CN1CCCC1=O.Cc1cc(C)sn1 |
| InChI | InChI=1S/C5H9NO.C5H7NS.C2H6/c1-6-4-2-3-5(6)7;1-4-3-5(2)7-6-4;1-2/h2-4H2,1H3;3H,1-2H3;1-2H3 |
| InChIKey | SKYXWEWHDQISRJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |