C8H12O2 — CID 168934307
6,6-dideuteriooct-7-ynoic acid (PubChem CID 168934307) has the molecular formula C8H12O2 and a molecular weight of 142.19 g/mol. Its IUPAC name is 6,6-dideuteriooct-7-ynoic acid.
| Compound Name | 6,6-dideuteriooct-7-ynoic acid |
|---|---|
| PubChem CID | 168934307 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 142.19 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 6,6-dideuteriooct-7-ynoic acid |
| SMILES | [2H]C([2H])(C#C)CCCCC(=O)O |
| InChI | InChI=1S/C8H12O2/c1-2-3-4-5-6-7-8(9)10/h1H,3-7H2,(H,9,10)/i3D2 |
| InChIKey | WJBHDZBQZOMDFF-SMZGMGDZSA-N |
| XLogP | 1.65 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.19 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|