C38H54ClF3N2O — CID 168972315
3-butyl-5-chloro-2-[1-(4-ethylphenyl)ethyl]-1H-indole;1-propoxypropane;N-[(1Z)-3-(trifluoromethyl)buta-1,3-dienyl]pentan-2-imine (PubChem CID 168972315) has the molecular formula C38H54ClF3N2O and a molecular weight of 647.31 g/mol. Its IUPAC name is 3-butyl-5-chloro-2-[1-(4-ethylphenyl)ethyl]-1H-indole;1-propoxypropane;N-[(1Z)-3-(trifluoromethyl)buta-1,3-dienyl]pentan-2-imine.
| Compound Name | 3-butyl-5-chloro-2-[1-(4-ethylphenyl)ethyl]-1H-indole;1-propoxypropane;N-[(1Z)-3-(trifluoromethyl)buta-1,3-dienyl]pentan-2-imine |
|---|---|
| PubChem CID | 168972315 |
| Molecular Formula | C38H54ClF3N2O |
| Molecular Weight | 647.31 g/mol |
| Exact Mass | 646.39 |
| IUPAC Name | 3-butyl-5-chloro-2-[1-(4-ethylphenyl)ethyl]-1H-indole;1-propoxypropane;N-[(1Z)-3-(trifluoromethyl)buta-1,3-dienyl]pentan-2-imine |
| SMILES | C=C(/C=C\N=C(/C)CCC)C(F)(F)F.CCCCc1c(C(C)c2ccc(CC)cc2)[nH]c2ccc(Cl)cc12.CCCOCCC |
| InChI | InChI=1S/C22H26ClN.C10H14F3N.C6H14O/c1-4-6-7-19-20-14-18(23)12-13-21(20)24-22(19)15(3)17-10-8-16(5-2)9-11-17;1-4-5-9(3)14-7-6-8(2)10(11,12)13;1-3-5-7-6-4-2/h8-15,24H,4-7H2,1-3H3;6-7H,2,4-5H2,1,3H3;3-6H2,1-2H3/b;7-6-,14-9+; |
| InChIKey | OFNOZQXRNMKVAF-AQQMPLAVSA-N |
| XLogP | 12.58 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.31 |
| LogP ≤ 5 | 12.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|