C20H20BClFN — CID 168972349
CID 168972349 (PubChem CID 168972349) has the molecular formula C20H20BClFN and a molecular weight of 339.65 g/mol.
| Compound Name | CID 168972349 |
|---|---|
| PubChem CID | 168972349 |
| Molecular Formula | C20H20BClFN |
| Molecular Weight | 339.65 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(C(C)c2[nH]c3ccc(Cl)cc3c2CCCC)c(F)c1 |
| InChI | InChI=1S/C20H20BClFN/c1-3-4-5-16-17-11-14(22)7-9-19(17)24-20(16)12(2)15-8-6-13(21)10-18(15)23/h6-12,24H,3-5H2,1-2H3 |
| InChIKey | UEYBUMFMYYQUMR-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.65 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|