C23H28ClN — CID 168972622
3-butyl-5-chloro-2-[1-(4-propylphenyl)ethyl]-1H-indole (PubChem CID 168972622) has the molecular formula C23H28ClN and a molecular weight of 353.94 g/mol. Its IUPAC name is 3-butyl-5-chloro-2-[1-(4-propylphenyl)ethyl]-1H-indole.
| Compound Name | 3-butyl-5-chloro-2-[1-(4-propylphenyl)ethyl]-1H-indole |
|---|---|
| PubChem CID | 168972622 |
| Molecular Formula | C23H28ClN |
| Molecular Weight | 353.94 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 3-butyl-5-chloro-2-[1-(4-propylphenyl)ethyl]-1H-indole |
| SMILES | CCCCc1c(C(C)c2ccc(CCC)cc2)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C23H28ClN/c1-4-6-8-20-21-15-19(24)13-14-22(21)25-23(20)16(3)18-11-9-17(7-5-2)10-12-18/h9-16,25H,4-8H2,1-3H3 |
| InChIKey | FSGAXTCEDWWJLC-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.94 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |