C35H51ClN2 — CID 168972420
3-butyl-5-chloro-2-[(1S)-1-(4-methylphenyl)ethyl]-1H-indole;2-methylpent-1-ene;N-[(E)-pent-2-en-2-yl]propan-1-imine (PubChem CID 168972420) has the molecular formula C35H51ClN2 and a molecular weight of 535.26 g/mol. Its IUPAC name is 3-butyl-5-chloro-2-[(1S)-1-(4-methylphenyl)ethyl]-1H-indole;2-methylpent-1-ene;N-[(E)-pent-2-en-2-yl]propan-1-imine.
| Compound Name | 3-butyl-5-chloro-2-[(1S)-1-(4-methylphenyl)ethyl]-1H-indole;2-methylpent-1-ene;N-[(E)-pent-2-en-2-yl]propan-1-imine |
|---|---|
| PubChem CID | 168972420 |
| Molecular Formula | C35H51ClN2 |
| Molecular Weight | 535.26 g/mol |
| Exact Mass | 534.37 |
| IUPAC Name | 3-butyl-5-chloro-2-[(1S)-1-(4-methylphenyl)ethyl]-1H-indole;2-methylpent-1-ene;N-[(E)-pent-2-en-2-yl]propan-1-imine |
| SMILES | C=C(C)CCC.CC/C=N/C(C)=C/CC.CCCCc1c([C@@H](C)c2ccc(C)cc2)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C21H24ClN.C8H15N.C6H12/c1-4-5-6-18-19-13-17(22)11-12-20(19)23-21(18)15(3)16-9-7-14(2)8-10-16;1-4-6-8(3)9-7-5-2;1-4-5-6(2)3/h7-13,15,23H,4-6H2,1-3H3;6-7H,4-5H2,1-3H3;2,4-5H2,1,3H3/b;8-6+,9-7+;/t15-;;/m0../s1 |
| InChIKey | JYDSRXRJCFLFGI-FFXLEROPSA-N |
| XLogP | 11.77 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.26 |
| LogP ≤ 5 | 11.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|