C41H62ClN3O — CID 168972791
3-butyl-2-[(Z,3E)-3-butylidene-6-methylideneoct-4-en-2-yl]-5-chloro-1H-indole;(Z)-2-methylidene-4-(pentan-2-ylideneamino)but-3-enenitrile;1-propoxypropane (PubChem CID 168972791) has the molecular formula C41H62ClN3O and a molecular weight of 648.42 g/mol. Its IUPAC name is 3-butyl-2-[(Z,3E)-3-butylidene-6-methylideneoct-4-en-2-yl]-5-chloro-1H-indole;(Z)-2-methylidene-4-(pentan-2-ylideneamino)but-3-enenitrile;1-propoxypropane.
| Compound Name | 3-butyl-2-[(Z,3E)-3-butylidene-6-methylideneoct-4-en-2-yl]-5-chloro-1H-indole;(Z)-2-methylidene-4-(pentan-2-ylideneamino)but-3-enenitrile;1-propoxypropane |
|---|---|
| PubChem CID | 168972791 |
| Molecular Formula | C41H62ClN3O |
| Molecular Weight | 648.42 g/mol |
| Exact Mass | 647.46 |
| IUPAC Name | 3-butyl-2-[(Z,3E)-3-butylidene-6-methylideneoct-4-en-2-yl]-5-chloro-1H-indole;(Z)-2-methylidene-4-(pentan-2-ylideneamino)but-3-enenitrile;1-propoxypropane |
| SMILES | C=C(/C=C\C(=C/CCC)C(C)c1[nH]c2ccc(Cl)cc2c1CCCC)CC.C=C(C#N)/C=C\N=C(/C)CCC.CCCOCCC |
| InChI | InChI=1S/C25H34ClN.C10H14N2.C6H14O/c1-6-9-11-20(14-13-18(4)8-3)19(5)25-22(12-10-7-2)23-17-21(26)15-16-24(23)27-25;1-4-5-10(3)12-7-6-9(2)8-11;1-3-5-7-6-4-2/h11,13-17,19,27H,4,6-10,12H2,1-3,5H3;6-7H,2,4-5H2,1,3H3;3-6H2,1-2H3/b14-13-,20-11+;7-6-,12-10+; |
| InChIKey | FPXQPNKQVZSIGC-VKWMZHTJSA-N |
| XLogP | 13.18 |
| TPSA | 61.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.42 |
| LogP ≤ 5 | 13.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|