C31H37ClF4N2 — CID 168972325
3-butyl-5-chloro-2-[1-(3-fluoro-4-methylphenyl)ethyl]-1H-indole;N-[(1Z)-3-(trifluoromethyl)buta-1,3-dienyl]pentan-2-imine (PubChem CID 168972325) has the molecular formula C31H37ClF4N2 and a molecular weight of 549.10 g/mol. Its IUPAC name is 3-butyl-5-chloro-2-[1-(3-fluoro-4-methylphenyl)ethyl]-1H-indole;N-[(1Z)-3-(trifluoromethyl)buta-1,3-dienyl]pentan-2-imine.
| Compound Name | 3-butyl-5-chloro-2-[1-(3-fluoro-4-methylphenyl)ethyl]-1H-indole;N-[(1Z)-3-(trifluoromethyl)buta-1,3-dienyl]pentan-2-imine |
|---|---|
| PubChem CID | 168972325 |
| Molecular Formula | C31H37ClF4N2 |
| Molecular Weight | 549.10 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | 3-butyl-5-chloro-2-[1-(3-fluoro-4-methylphenyl)ethyl]-1H-indole;N-[(1Z)-3-(trifluoromethyl)buta-1,3-dienyl]pentan-2-imine |
| SMILES | C=C(/C=C\N=C(/C)CCC)C(F)(F)F.CCCCc1c(C(C)c2ccc(C)c(F)c2)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C21H23ClFN.C10H14F3N/c1-4-5-6-17-18-12-16(22)9-10-20(18)24-21(17)14(3)15-8-7-13(2)19(23)11-15;1-4-5-9(3)14-7-6-8(2)10(11,12)13/h7-12,14,24H,4-6H2,1-3H3;6-7H,2,4-5H2,1,3H3/b;7-6-,14-9+ |
| InChIKey | SNSQSEARVFWGEA-IGXIFWQCSA-N |
| XLogP | 10.64 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.10 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|