C34H44ClF5N2 — CID 168972421
3-butyl-5-chloro-2-[1-(2,3-difluoro-4-methylphenyl)ethyl]-1H-indole;N-[(E)-pent-2-en-2-yl]butan-2-imine;3,3,3-trifluoro-2-methylprop-1-ene (PubChem CID 168972421) has the molecular formula C34H44ClF5N2 and a molecular weight of 611.18 g/mol. Its IUPAC name is 3-butyl-5-chloro-2-[1-(2,3-difluoro-4-methylphenyl)ethyl]-1H-indole;N-[(E)-pent-2-en-2-yl]butan-2-imine;3,3,3-trifluoro-2-methylprop-1-ene.
| Compound Name | 3-butyl-5-chloro-2-[1-(2,3-difluoro-4-methylphenyl)ethyl]-1H-indole;N-[(E)-pent-2-en-2-yl]butan-2-imine;3,3,3-trifluoro-2-methylprop-1-ene |
|---|---|
| PubChem CID | 168972421 |
| Molecular Formula | C34H44ClF5N2 |
| Molecular Weight | 611.18 g/mol |
| Exact Mass | 610.31 |
| IUPAC Name | 3-butyl-5-chloro-2-[1-(2,3-difluoro-4-methylphenyl)ethyl]-1H-indole;N-[(E)-pent-2-en-2-yl]butan-2-imine;3,3,3-trifluoro-2-methylprop-1-ene |
| SMILES | C=C(C)C(F)(F)F.CC/C=C(C)/N=C(\C)CC.CCCCc1c(C(C)c2ccc(C)c(F)c2F)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C21H22ClF2N.C9H17N.C4H5F3/c1-4-5-6-16-17-11-14(22)8-10-18(17)25-21(16)13(3)15-9-7-12(2)19(23)20(15)24;1-5-7-9(4)10-8(3)6-2;1-3(2)4(5,6)7/h7-11,13,25H,4-6H2,1-3H3;7H,5-6H2,1-4H3;1H2,2H3/b;9-7+,10-8+; |
| InChIKey | DGWUKVRWMQHQNU-WMSDLXSESA-N |
| XLogP | 12.20 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.18 |
| LogP ≤ 5 | 12.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|