C35H34FN5O3S — CID 169133946
1-[2-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-1-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridin-5-yl]prop-2-en-1-one (PubChem CID 169133946) has the molecular formula C35H34FN5O3S and a molecular weight of 623.75 g/mol. Its IUPAC name is 1-[2-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-1-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridin-5-yl]prop-2-en-1-one.
| Compound Name | 1-[2-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-1-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridin-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 169133946 |
| Molecular Formula | C35H34FN5O3S |
| Molecular Weight | 623.75 g/mol |
| Exact Mass | 623.24 |
| IUPAC Name | 1-[2-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-1-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridin-5-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCc2c(nc(-c3nc(-c4ccc5c(c4)CCNC5)c4ccsc4c3-c3ccc(F)cc3OCCOC)n2C)C1 |
| InChI | InChI=1S/C35H34FN5O3S/c1-4-30(42)41-13-10-28-27(20-41)38-35(40(28)2)33-31(25-8-7-24(36)18-29(25)44-15-14-43-3)34-26(11-16-45-34)32(39-33)22-5-6-23-19-37-12-9-21(23)17-22/h4-8,11,16-18,37H,1,9-10,12-15,19-20H2,2-3H3 |
| InChIKey | KISPGOQIVZGKFB-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.75 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|