C19H31FN4OS — CID 169139314
(Z)-1-[amino(3-fluoropropyl)amino]-3-(2-ethylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl)prop-1-en-2-amine (PubChem CID 169139314) has the molecular formula C19H31FN4OS and a molecular weight of 382.55 g/mol. Its IUPAC name is (Z)-1-[amino(3-fluoropropyl)amino]-3-(2-ethylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl)prop-1-en-2-amine.
| Compound Name | (Z)-1-[amino(3-fluoropropyl)amino]-3-(2-ethylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl)prop-1-en-2-amine |
|---|---|
| PubChem CID | 169139314 |
| Molecular Formula | C19H31FN4OS |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | (Z)-1-[amino(3-fluoropropyl)amino]-3-(2-ethylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl)prop-1-en-2-amine |
| SMILES | CCc1cc2c(s1)CCOC21CCN(C/C(N)=C/N(N)CCCF)CC1 |
| InChI | InChI=1S/C19H31FN4OS/c1-2-16-12-17-18(26-16)4-11-25-19(17)5-9-23(10-6-19)13-15(21)14-24(22)8-3-7-20/h12,14H,2-11,13,21-22H2,1H3/b15-14- |
| InChIKey | JTBLJSNEPAIDMZ-PFONDFGASA-N |
| XLogP | 2.51 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|