C24H32N2OSi — CID 169181451
2-[1-[2-[tert-butyl(diphenyl)silyl]oxyethylamino]ethyl]cyclopropane-1-carbonitrile (PubChem CID 169181451) has the molecular formula C24H32N2OSi and a molecular weight of 392.62 g/mol. Its IUPAC name is 2-[1-[2-[tert-butyl(diphenyl)silyl]oxyethylamino]ethyl]cyclopropane-1-carbonitrile.
| Compound Name | 2-[1-[2-[tert-butyl(diphenyl)silyl]oxyethylamino]ethyl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 169181451 |
| Molecular Formula | C24H32N2OSi |
| Molecular Weight | 392.62 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 2-[1-[2-[tert-butyl(diphenyl)silyl]oxyethylamino]ethyl]cyclopropane-1-carbonitrile |
| SMILES | CC(NCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C1CC1C#N |
| InChI | InChI=1S/C24H32N2OSi/c1-19(23-17-20(23)18-25)26-15-16-27-28(24(2,3)4,21-11-7-5-8-12-21)22-13-9-6-10-14-22/h5-14,19-20,23,26H,15-17H2,1-4H3 |
| InChIKey | HYZJLJDYVCZGRH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.62 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|