C25H33NO2Si — CID 66918652
(1R,2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-propan-2-yloxycyclopentane-1-carbonitrile (PubChem CID 66918652) has the molecular formula C25H33NO2Si and a molecular weight of 407.63 g/mol. Its IUPAC name is (1R,2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-propan-2-yloxycyclopentane-1-carbonitrile.
| Compound Name | (1R,2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-propan-2-yloxycyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 66918652 |
| Molecular Formula | C25H33NO2Si |
| Molecular Weight | 407.63 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | (1R,2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-propan-2-yloxycyclopentane-1-carbonitrile |
| SMILES | CC(C)O[C@H]1C[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@@H]1C#N |
| InChI | InChI=1S/C25H33NO2Si/c1-19(2)27-24-17-21(16-20(24)18-26)28-29(25(3,4)5,22-12-8-6-9-13-22)23-14-10-7-11-15-23/h6-15,19-21,24H,16-17H2,1-5H3/t20-,21-,24+/m1/s1 |
| InChIKey | GPTVSWWLTOVZQU-LGVFNWMJSA-N |
| XLogP | 4.66 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.63 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|