About ethane;1-propan-2-ylpiperidin-5-ide;rubidium(1+)
ethane;1-propan-2-ylpiperidin-5-ide;rubidium(1+) (PubChem CID 169182346) has the molecular formula C10H22NRb
and a molecular weight of 241.76 g/mol. Its IUPAC name is ethane;1-propan-2-ylpiperidin-5-ide;rubidium(1+).
Molecular Properties
| Compound Name | ethane;1-propan-2-ylpiperidin-5-ide;rubidium(1+) |
| PubChem CID | 169182346 |
| Molecular Formula | C10H22NRb |
| Molecular Weight | 241.76 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | ethane;1-propan-2-ylpiperidin-5-ide;rubidium(1+) |
| SMILES | CC.CC(C)N1C[CH-]CCC1.[Rb+] |
| InChI | InChI=1S/C8H16N.C2H6.Rb/c1-8(2)9-6-4-3-5-7-9;1-2;/h4,8H,3,5-7H2,1-2H3;1-2H3;/q-1;;+1 |
| InChIKey | YPFGOFLBTNANRC-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.76 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-propan-2-ylpiperidin-5-ide;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-propan-2-ylpiperidin-5-ide;rubidium(1+)?
The IUPAC name of ethane;1-propan-2-ylpiperidin-5-ide;rubidium(1+) (CID 169182346) is ethane;1-propan-2-ylpiperidin-5-ide;rubidium(1+).
What is the SMILES notation for ethane;1-propan-2-ylpiperidin-5-ide;rubidium(1+)?
The canonical SMILES for ethane;1-propan-2-ylpiperidin-5-ide;rubidium(1+) is CC.CC(C)N1C[CH-]CCC1.[Rb+].
What is the InChIKey of ethane;1-propan-2-ylpiperidin-5-ide;rubidium(1+)?
The InChIKey is YPFGOFLBTNANRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N.C2H6.Rb/c1-8(2)9-6-4-3-5-7-9;1-2;/h4,8H,3,5-7H2,1-2H3;1-2H3;/q-1;;+1.
What are the key properties of ethane;1-propan-2-ylpiperidin-5-ide;rubidium(1+)?
ethane;1-propan-2-ylpiperidin-5-ide;rubidium(1+) has a molecular weight of 241.76 g/mol, XLogP of -0.27, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-propan-2-ylpiperidin-5-ide;rubidium(1+) is sourced from PubChem (CID 169182346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).