About ethane;1-propan-2-ylpyrrolidin-4-ide;rhenium
ethane;1-propan-2-ylpyrrolidin-4-ide;rhenium (PubChem CID 171658478) has the molecular formula C9H20NRe-
and a molecular weight of 328.47 g/mol. Its IUPAC name is ethane;1-propan-2-ylpyrrolidin-4-ide;rhenium.
Molecular Properties
| Compound Name | ethane;1-propan-2-ylpyrrolidin-4-ide;rhenium |
| PubChem CID | 171658478 |
| Molecular Formula | C9H20NRe- |
| Molecular Weight | 328.47 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | ethane;1-propan-2-ylpyrrolidin-4-ide;rhenium |
| SMILES | CC.CC(C)N1C[CH-]CC1.[Re] |
| InChI | InChI=1S/C7H14N.C2H6.Re/c1-7(2)8-5-3-4-6-8;1-2;/h3,7H,4-6H2,1-2H3;1-2H3;/q-1;; |
| InChIKey | KUZMRQCRSONSCK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.47 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-propan-2-ylpyrrolidin-4-ide;rhenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-propan-2-ylpyrrolidin-4-ide;rhenium?
The IUPAC name of ethane;1-propan-2-ylpyrrolidin-4-ide;rhenium (CID 171658478) is ethane;1-propan-2-ylpyrrolidin-4-ide;rhenium.
What is the SMILES notation for ethane;1-propan-2-ylpyrrolidin-4-ide;rhenium?
The canonical SMILES for ethane;1-propan-2-ylpyrrolidin-4-ide;rhenium is CC.CC(C)N1C[CH-]CC1.[Re].
What is the InChIKey of ethane;1-propan-2-ylpyrrolidin-4-ide;rhenium?
The InChIKey is KUZMRQCRSONSCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N.C2H6.Re/c1-7(2)8-5-3-4-6-8;1-2;/h3,7H,4-6H2,1-2H3;1-2H3;/q-1;;.
What are the key properties of ethane;1-propan-2-ylpyrrolidin-4-ide;rhenium?
ethane;1-propan-2-ylpyrrolidin-4-ide;rhenium has a molecular weight of 328.47 g/mol, XLogP of 2.33, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-propan-2-ylpyrrolidin-4-ide;rhenium is sourced from PubChem (CID 171658478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).