C18H15BrCl2N4O2 — CID 169197134
(9-bromo-6,7-dichloro-1-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(5-methoxypyrimidin-2-yl)methanone (PubChem CID 169197134) has the molecular formula C18H15BrCl2N4O2 and a molecular weight of 470.15 g/mol. Its IUPAC name is (9-bromo-6,7-dichloro-1-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(5-methoxypyrimidin-2-yl)methanone.
| Compound Name | (9-bromo-6,7-dichloro-1-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(5-methoxypyrimidin-2-yl)methanone |
|---|---|
| PubChem CID | 169197134 |
| Molecular Formula | C18H15BrCl2N4O2 |
| Molecular Weight | 470.15 g/mol |
| Exact Mass | 467.98 |
| IUPAC Name | (9-bromo-6,7-dichloro-1-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(5-methoxypyrimidin-2-yl)methanone |
| SMILES | COc1cnc(C(=O)N2CCc3[nH]c4c(Cl)c(Cl)cc(Br)c4c3C2C)nc1 |
| InChI | InChI=1S/C18H15BrCl2N4O2/c1-8-13-12(24-16-14(13)10(19)5-11(20)15(16)21)3-4-25(8)18(26)17-22-6-9(27-2)7-23-17/h5-8,24H,3-4H2,1-2H3 |
| InChIKey | WAUSAFIVKCFFNE-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.15 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|