C17H22N4O8P+ — CID 169210943
[(2E,4Z)-3-[5-(3-dihydroxyphosphanyloxy-4-hydroxy-5-nitrophenyl)-1,2,4-oxadiazol-3-yl]-4,5-dimethylhepta-2,4-dien-2-yl]-hydroxyazanium (PubChem CID 169210943) has the molecular formula C17H22N4O8P+ and a molecular weight of 441.36 g/mol. Its IUPAC name is [(2E,4Z)-3-[5-(3-dihydroxyphosphanyloxy-4-hydroxy-5-nitrophenyl)-1,2,4-oxadiazol-3-yl]-4,5-dimethylhepta-2,4-dien-2-yl]-hydroxyazanium.
| Compound Name | [(2E,4Z)-3-[5-(3-dihydroxyphosphanyloxy-4-hydroxy-5-nitrophenyl)-1,2,4-oxadiazol-3-yl]-4,5-dimethylhepta-2,4-dien-2-yl]-hydroxyazanium |
|---|---|
| PubChem CID | 169210943 |
| Molecular Formula | C17H22N4O8P+ |
| Molecular Weight | 441.36 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | [(2E,4Z)-3-[5-(3-dihydroxyphosphanyloxy-4-hydroxy-5-nitrophenyl)-1,2,4-oxadiazol-3-yl]-4,5-dimethylhepta-2,4-dien-2-yl]-hydroxyazanium |
| SMILES | CC/C(C)=C(C)\C(=C(\C)[NH2+]O)c1noc(-c2cc(OP(O)O)c(O)c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C17H21N4O8P/c1-5-8(2)9(3)14(10(4)19-23)16-18-17(28-20-16)11-6-12(21(24)25)15(22)13(7-11)29-30(26)27/h6-7,19,22-23,26-27H,5H2,1-4H3/p+1/b9-8-,14-10+ |
| InChIKey | RTPKQOZFNWSJHZ-MYSCJDEHSA-O |
| XLogP | 2.37 |
| TPSA | 188.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|