C16H13Cl2N4O6- — CID 169210938
4-[3-[(1Z,3E)-1,4-dichloro-1-(hydroxyamino)-3,5-dimethylhexa-1,3,5-trien-2-yl]-1,2,4-oxadiazol-5-yl]-2-hydroxy-6-nitrophenolate (PubChem CID 169210938) has the molecular formula C16H13Cl2N4O6- and a molecular weight of 428.21 g/mol. Its IUPAC name is 4-[3-[(1Z,3E)-1,4-dichloro-1-(hydroxyamino)-3,5-dimethylhexa-1,3,5-trien-2-yl]-1,2,4-oxadiazol-5-yl]-2-hydroxy-6-nitrophenolate.
| Compound Name | 4-[3-[(1Z,3E)-1,4-dichloro-1-(hydroxyamino)-3,5-dimethylhexa-1,3,5-trien-2-yl]-1,2,4-oxadiazol-5-yl]-2-hydroxy-6-nitrophenolate |
|---|---|
| PubChem CID | 169210938 |
| Molecular Formula | C16H13Cl2N4O6- |
| Molecular Weight | 428.21 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | 4-[3-[(1Z,3E)-1,4-dichloro-1-(hydroxyamino)-3,5-dimethylhexa-1,3,5-trien-2-yl]-1,2,4-oxadiazol-5-yl]-2-hydroxy-6-nitrophenolate |
| SMILES | C=C(C)/C(Cl)=C(C)\C(=C(\Cl)NO)c1noc(-c2cc(O)c([O-])c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C16H14Cl2N4O6/c1-6(2)12(17)7(3)11(14(18)20-25)15-19-16(28-21-15)8-4-9(22(26)27)13(24)10(23)5-8/h4-5,20,23-25H,1H2,2-3H3/p-1/b12-7+,14-11+ |
| InChIKey | IHTOXYZZMBUIHK-XUIQRUTDSA-M |
| XLogP | 3.40 |
| TPSA | 157.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.21 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|