C20H21N5O5 — CID 169211230
N-[11-(methylamino)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-5-yl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 169211230) has the molecular formula C20H21N5O5 and a molecular weight of 411.42 g/mol. Its IUPAC name is N-[11-(methylamino)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-5-yl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-[11-(methylamino)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-5-yl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 169211230 |
| Molecular Formula | C20H21N5O5 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | N-[11-(methylamino)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-5-yl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CNC1CC2C(=O)N3CC(NC(=O)c4ccc5c(c4)C(=O)NC5=O)CC3C(=O)N2C1 |
| InChI | InChI=1S/C20H21N5O5/c1-21-10-5-14-19(29)25-8-11(6-15(25)20(30)24(14)7-10)22-16(26)9-2-3-12-13(4-9)18(28)23-17(12)27/h2-4,10-11,14-15,21H,5-8H2,1H3,(H,22,26)(H,23,27,28) |
| InChIKey | OMWJVBRBPGVULI-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|